C24H38BFN9O2 — CID 159667100
CID 159667100 (PubChem CID 159667100) has the molecular formula C24H38BFN9O2 and a molecular weight of 514.44 g/mol.
| Compound Name | CID 159667100 |
|---|---|
| PubChem CID | 159667100 |
| Molecular Formula | C24H38BFN9O2 |
| Molecular Weight | 514.44 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | — |
| SMILES | CCNc1ncc(F)c(Nc2n[nH]c3c2CN(C(=O)N2C[C@H](C)N(CCCOC)C[C@@H]2C)C3(C)C)n1.[B] |
| InChI | InChI=1S/C24H38FN9O2.B/c1-7-26-22-27-11-18(25)21(29-22)28-20-17-14-34(24(4,5)19(17)30-31-20)23(35)33-13-15(2)32(12-16(33)3)9-8-10-36-6;/h11,15-16H,7-10,12-14H2,1-6H3,(H3,26,27,28,29,30,31);/t15-,16-;/m0./s1 |
| InChIKey | HPHJSKPOENHHGR-MOGJOVFKSA-N |
| XLogP | 2.74 |
| TPSA | 114.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|