C23H26N2O4S — CID 143738795
3-[3-[2-[2-[[(1S,2S)-2-ethenylcyclopropyl]oxymethylamino]sulfanylanilino]-2-oxoethyl]phenyl]propanoic acid (PubChem CID 143738795) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3-[3-[2-[2-[[(1S,2S)-2-ethenylcyclopropyl]oxymethylamino]sulfanylanilino]-2-oxoethyl]phenyl]propanoic acid.
| Compound Name | 3-[3-[2-[2-[[(1S,2S)-2-ethenylcyclopropyl]oxymethylamino]sulfanylanilino]-2-oxoethyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143738795 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[3-[2-[2-[[(1S,2S)-2-ethenylcyclopropyl]oxymethylamino]sulfanylanilino]-2-oxoethyl]phenyl]propanoic acid |
| SMILES | C=C[C@@H]1C[C@@H]1OCNSc1ccccc1NC(=O)Cc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C23H26N2O4S/c1-2-18-14-20(18)29-15-24-30-21-9-4-3-8-19(21)25-22(26)13-17-7-5-6-16(12-17)10-11-23(27)28/h2-9,12,18,20,24H,1,10-11,13-15H2,(H,25,26)(H,27,28)/t18-,20+/m1/s1 |
| InChIKey | ZLICUXCSIJGDQN-QUCCMNQESA-N |
| XLogP | 4.03 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|