C19H24N2O5S — CID 143738877
(2S)-2-ethenyl-N-[2-[[2-[2-(3-oxopropoxy)ethoxy]acetyl]amino]phenyl]sulfanylcyclopropane-1-carboxamide (PubChem CID 143738877) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is (2S)-2-ethenyl-N-[2-[[2-[2-(3-oxopropoxy)ethoxy]acetyl]amino]phenyl]sulfanylcyclopropane-1-carboxamide.
| Compound Name | (2S)-2-ethenyl-N-[2-[[2-[2-(3-oxopropoxy)ethoxy]acetyl]amino]phenyl]sulfanylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 143738877 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (2S)-2-ethenyl-N-[2-[[2-[2-(3-oxopropoxy)ethoxy]acetyl]amino]phenyl]sulfanylcyclopropane-1-carboxamide |
| SMILES | C=C[C@@H]1CC1C(=O)NSc1ccccc1NC(=O)COCCOCCC=O |
| InChI | InChI=1S/C19H24N2O5S/c1-2-14-12-15(14)19(24)21-27-17-7-4-3-6-16(17)20-18(23)13-26-11-10-25-9-5-8-22/h2-4,6-8,14-15H,1,5,9-13H2,(H,20,23)(H,21,24)/t14-,15?/m1/s1 |
| InChIKey | VMZCNERYLXCYED-GICMACPYSA-N |
| XLogP | 2.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|