C9H14N2 — CID 143739126
2-N-propylcyclohex-3-ene-1,2-diimine (PubChem CID 143739126) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-N-propylcyclohex-3-ene-1,2-diimine.
| Compound Name | 2-N-propylcyclohex-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 143739126 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-N-propylcyclohex-3-ene-1,2-diimine |
| SMILES | [H]/N=C1\CCC=C\C1=N/CCC |
| InChI | InChI=1S/C9H14N2/c1-2-7-11-9-6-4-3-5-8(9)10/h4,6,10H,2-3,5,7H2,1H3/b10-8+,11-9+ |
| InChIKey | AXPLNGLCICSRMY-GFULKKFKSA-N |
| XLogP | 2.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|