C13H20F2 — CID 143740703
1-(2,2-difluoroethyl)-3-ethylbenzene;propane (PubChem CID 143740703) has the molecular formula C13H20F2 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-ethylbenzene;propane.
| Compound Name | 1-(2,2-difluoroethyl)-3-ethylbenzene;propane |
|---|---|
| PubChem CID | 143740703 |
| Molecular Formula | C13H20F2 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-ethylbenzene;propane |
| SMILES | CCC.CCc1cccc(CC(F)F)c1 |
| InChI | InChI=1S/C10H12F2.C3H8/c1-2-8-4-3-5-9(6-8)7-10(11)12;1-3-2/h3-6,10H,2,7H2,1H3;3H2,1-2H3 |
| InChIKey | LMFASDDEYUNBFA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |