C8H12N4OS — CID 143743983
ethane;5-imino-6-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one (PubChem CID 143743983) has the molecular formula C8H12N4OS and a molecular weight of 212.28 g/mol. Its IUPAC name is ethane;5-imino-6-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one.
| Compound Name | ethane;5-imino-6-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
|---|---|
| PubChem CID | 143743983 |
| Molecular Formula | C8H12N4OS |
| Molecular Weight | 212.28 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | ethane;5-imino-6-methyl-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-one |
| SMILES | CC.[H]/N=C1\C(C)C(=O)N=C2SC=NN21 |
| InChI | InChI=1S/C6H6N4OS.C2H6/c1-3-4(7)10-6(9-5(3)11)12-2-8-10;1-2/h2-3,7H,1H3;1-2H3/b7-4+; |
| InChIKey | MDECZUMLAOMOPK-KQGICBIGSA-N |
| XLogP | 1.51 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|