C8H13N3O2S — CID 143748017
ethyl (2E)-2-(2-methylimino-1,3,4-thiadiazinan-5-ylidene)acetate (PubChem CID 143748017) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is ethyl (2E)-2-(2-methylimino-1,3,4-thiadiazinan-5-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(2-methylimino-1,3,4-thiadiazinan-5-ylidene)acetate |
|---|---|
| PubChem CID | 143748017 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | ethyl (2E)-2-(2-methylimino-1,3,4-thiadiazinan-5-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\CS/C(=N\C)NN1 |
| InChI | InChI=1S/C8H13N3O2S/c1-3-13-7(12)4-6-5-14-8(9-2)11-10-6/h4,10H,3,5H2,1-2H3,(H,9,11)/b6-4+ |
| InChIKey | JKPPOXQMPUVBBD-GQCTYLIASA-N |
| XLogP | 0.26 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|