C22H19NO2 — CID 143748218
3-(benzylamino)-4-[3-ethenyl-2-[(Z)-prop-1-enyl]phenyl]cyclobut-3-ene-1,2-dione (PubChem CID 143748218) has the molecular formula C22H19NO2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(benzylamino)-4-[3-ethenyl-2-[(Z)-prop-1-enyl]phenyl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(benzylamino)-4-[3-ethenyl-2-[(Z)-prop-1-enyl]phenyl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 143748218 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-(benzylamino)-4-[3-ethenyl-2-[(Z)-prop-1-enyl]phenyl]cyclobut-3-ene-1,2-dione |
| SMILES | C=Cc1cccc(-c2c(NCc3ccccc3)c(=O)c2=O)c1/C=C\C |
| InChI | InChI=1S/C22H19NO2/c1-3-9-17-16(4-2)12-8-13-18(17)19-20(22(25)21(19)24)23-14-15-10-6-5-7-11-15/h3-13,23H,2,14H2,1H3/b9-3- |
| InChIKey | DGIYGALUMFJDMD-OQFOIZHKSA-N |
| XLogP | 4.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|