C13H20O — CID 143751467
(2E,3Z)-2,3-bis(prop-2-enylidene)cyclopentan-1-ol;ethane (PubChem CID 143751467) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2E,3Z)-2,3-bis(prop-2-enylidene)cyclopentan-1-ol;ethane.
| Compound Name | (2E,3Z)-2,3-bis(prop-2-enylidene)cyclopentan-1-ol;ethane |
|---|---|
| PubChem CID | 143751467 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2E,3Z)-2,3-bis(prop-2-enylidene)cyclopentan-1-ol;ethane |
| SMILES | C=C/C=C1/CCC(O)/C1=C/C=C.CC |
| InChI | InChI=1S/C11H14O.C2H6/c1-3-5-9-7-8-11(12)10(9)6-4-2;1-2/h3-6,11-12H,1-2,7-8H2;1-2H3/b9-5-,10-6+; |
| InChIKey | NNKFQJOESZTKGD-KSTRYXAPSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |