C16H16FNOS — CID 143753149
17-fluoro-10-oxa-2-thia-13-azatricyclo[13.4.0.03,8]nonadeca-1(15),3,5,7,16,18-hexaene (PubChem CID 143753149) has the molecular formula C16H16FNOS and a molecular weight of 289.38 g/mol. Its IUPAC name is 17-fluoro-10-oxa-2-thia-13-azatricyclo[13.4.0.03,8]nonadeca-1(15),3,5,7,16,18-hexaene.
| Compound Name | 17-fluoro-10-oxa-2-thia-13-azatricyclo[13.4.0.03,8]nonadeca-1(15),3,5,7,16,18-hexaene |
|---|---|
| PubChem CID | 143753149 |
| Molecular Formula | C16H16FNOS |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 17-fluoro-10-oxa-2-thia-13-azatricyclo[13.4.0.03,8]nonadeca-1(15),3,5,7,16,18-hexaene |
| SMILES | Fc1ccc2c(c1)CNCCOCc1ccccc1S2 |
| InChI | InChI=1S/C16H16FNOS/c17-14-5-6-16-13(9-14)10-18-7-8-19-11-12-3-1-2-4-15(12)20-16/h1-6,9,18H,7-8,10-11H2 |
| InChIKey | KIXYWGUUPLLXFE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |