C17H16FNOS — CID 25183142
3-fluorospiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] (PubChem CID 25183142) has the molecular formula C17H16FNOS and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-fluorospiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine].
| Compound Name | 3-fluorospiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] |
|---|---|
| PubChem CID | 25183142 |
| Molecular Formula | C17H16FNOS |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 3-fluorospiro[6H-benzo[b][1]benzothiepine-5,2'-morpholine] |
| SMILES | Fc1ccc2c(c1)C1(CNCCO1)Cc1ccccc1S2 |
| InChI | InChI=1S/C17H16FNOS/c18-13-5-6-16-14(9-13)17(11-19-7-8-20-17)10-12-3-1-2-4-15(12)21-16/h1-6,9,19H,7-8,10-11H2 |
| InChIKey | NHSQQILULXNJDN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |