C10H16N2 — CID 143756815
5-cyclopentyl-N-methyl-1,3-dihydropyrrol-2-imine (PubChem CID 143756815) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is 5-cyclopentyl-N-methyl-1,3-dihydropyrrol-2-imine.
| Compound Name | 5-cyclopentyl-N-methyl-1,3-dihydropyrrol-2-imine |
|---|---|
| PubChem CID | 143756815 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 5-cyclopentyl-N-methyl-1,3-dihydropyrrol-2-imine |
| SMILES | C/N=C1\CC=C(C2CCCC2)N1 |
| InChI | InChI=1S/C10H16N2/c1-11-10-7-6-9(12-10)8-4-2-3-5-8/h6,8H,2-5,7H2,1H3,(H,11,12) |
| InChIKey | CBVXYDLWWDXOBC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|