C15H28N6 — CID 163879729
6-[(Z)-5-(butan-2-ylideneamino)-3-ethylhex-4-enyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine (PubChem CID 163879729) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 6-[(Z)-5-(butan-2-ylideneamino)-3-ethylhex-4-enyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(Z)-5-(butan-2-ylideneamino)-3-ethylhex-4-enyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 163879729 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 6-[(Z)-5-(butan-2-ylideneamino)-3-ethylhex-4-enyl]-1,4-dihydro-1,3,5-triazine-2,4-diamine |
| SMILES | CC/C(C)=N/C(C)=C\C(CC)CCC1=NC(N)N=C(N)N1 |
| InChI | InChI=1S/C15H28N6/c1-5-10(3)18-11(4)9-12(6-2)7-8-13-19-14(16)21-15(17)20-13/h9,12,14H,5-8,16H2,1-4H3,(H3,17,19,20,21)/b11-9-,18-10+ |
| InChIKey | PSCBTUOBFRWCPB-GWNMMOMOSA-N |
| XLogP | 2.13 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|