C16H20N6O — CID 143756890
3-(1-ethylpyrazol-4-yl)-N-(oxan-4-yl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143756890) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 3-(1-ethylpyrazol-4-yl)-N-(oxan-4-yl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-(1-ethylpyrazol-4-yl)-N-(oxan-4-yl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143756890 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-(1-ethylpyrazol-4-yl)-N-(oxan-4-yl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCn1cc(-c2cnc3c(NC4CCOCC4)nccn23)cn1 |
| InChI | InChI=1S/C16H20N6O/c1-2-21-11-12(9-19-21)14-10-18-16-15(17-5-6-22(14)16)20-13-3-7-23-8-4-13/h5-6,9-11,13H,2-4,7-8H2,1H3,(H,17,20) |
| InChIKey | UFTJLIOUEZSBQX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 69.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |