About 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine
3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine (PubChem CID 71196531) has the molecular formula C11H13N7
and a molecular weight of 243.27 g/mol. Its IUPAC name is 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine.
Molecular Properties
| Compound Name | 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine |
| PubChem CID | 71196531 |
| Molecular Formula | C11H13N7 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine |
| SMILES | CCNc1nccn2c(-c3cnn(N)c3)cnc12 |
| InChI | InChI=1S/C11H13N7/c1-2-13-10-11-15-6-9(17(11)4-3-14-10)8-5-16-18(12)7-8/h3-7H,2,12H2,1H3,(H,13,14) |
| InChIKey | BIZXZBIWTXXZRV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine?
The IUPAC name of 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine (CID 71196531) is 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine.
What is the SMILES notation for 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine?
The canonical SMILES for 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine is CCNc1nccn2c(-c3cnn(N)c3)cnc12.
What is the InChIKey of 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine?
The InChIKey is BIZXZBIWTXXZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N7/c1-2-13-10-11-15-6-9(17(11)4-3-14-10)8-5-16-18(12)7-8/h3-7H,2,12H2,1H3,(H,13,14).
What are the key properties of 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine?
3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine has a molecular weight of 243.27 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminopyrazol-4-yl)-N-ethylimidazo[1,2-a]pyrazin-8-amine is sourced from PubChem (CID 71196531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).