C9H7N5 — CID 143757781
10-ethenyl-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 143757781) has the molecular formula C9H7N5 and a molecular weight of 185.19 g/mol. Its IUPAC name is 10-ethenyl-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-ethenyl-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 143757781 |
| Molecular Formula | C9H7N5 |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | 10-ethenyl-3,5,8,10,11-pentazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | C=Cn1ncc2c1N=CC1N=CN=C21 |
| InChI | InChI=1S/C9H7N5/c1-2-14-9-6(3-13-14)8-7(4-10-9)11-5-12-8/h2-5,7H,1H2 |
| InChIKey | QRPNVRBYTRCKDJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |