About 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine
1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine (PubChem CID 163938609) has the molecular formula C8H11N5
and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine.
Molecular Properties
| Compound Name | 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine |
| PubChem CID | 163938609 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=NCNc2c1cnn2C |
| InChI | InChI=1S/C8H11N5/c1-5(9)7-6-3-12-13(2)8(6)11-4-10-7/h3,9,11H,4H2,1-2H3/b9-5+ |
| InChIKey | RPAFMQGLWTVHPC-WEVVVXLNSA-N |
| XLogP | 0.63 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine?
The IUPAC name of 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine (CID 163938609) is 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine.
What is the SMILES notation for 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine?
The canonical SMILES for 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine is [H]/N=C(\C)C1=NCNc2c1cnn2C.
What is the InChIKey of 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine?
The InChIKey is RPAFMQGLWTVHPC-WEVVVXLNSA-N. The full InChI is InChI=1S/C8H11N5/c1-5(9)7-6-3-12-13(2)8(6)11-4-10-7/h3,9,11H,4H2,1-2H3/b9-5+.
What are the key properties of 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine?
1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine has a molecular weight of 177.21 g/mol, XLogP of 0.63, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine is sourced from PubChem (CID 163938609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).