C8H11N5 — CID 163938609
1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine (PubChem CID 163938609) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine.
| Compound Name | 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine |
|---|---|
| PubChem CID | 163938609 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-(1-methyl-6,7-dihydropyrazolo[5,4-d]pyrimidin-4-yl)ethanimine |
| SMILES | [H]/N=C(\C)C1=NCNc2c1cnn2C |
| InChI | InChI=1S/C8H11N5/c1-5(9)7-6-3-12-13(2)8(6)11-4-10-7/h3,9,11H,4H2,1-2H3/b9-5+ |
| InChIKey | RPAFMQGLWTVHPC-WEVVVXLNSA-N |
| XLogP | 0.63 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|