C26H39N — CID 143757893
ethane;4-[7-ethenyl-6-[(Z)-prop-1-enyl]-5H-benzo[7]annulen-5-yl]-1-methylpiperidine (PubChem CID 143757893) has the molecular formula C26H39N and a molecular weight of 365.61 g/mol. Its IUPAC name is ethane;4-[7-ethenyl-6-[(Z)-prop-1-enyl]-5H-benzo[7]annulen-5-yl]-1-methylpiperidine.
| Compound Name | ethane;4-[7-ethenyl-6-[(Z)-prop-1-enyl]-5H-benzo[7]annulen-5-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 143757893 |
| Molecular Formula | C26H39N |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | ethane;4-[7-ethenyl-6-[(Z)-prop-1-enyl]-5H-benzo[7]annulen-5-yl]-1-methylpiperidine |
| SMILES | C=CC1=C(/C=C\C)C(C2CCN(C)CC2)c2ccccc2C=C1.CC.CC |
| InChI | InChI=1S/C22H27N.2C2H6/c1-4-8-20-17(5-2)11-12-18-9-6-7-10-21(18)22(20)19-13-15-23(3)16-14-19;2*1-2/h4-12,19,22H,2,13-16H2,1,3H3;2*1-2H3/b8-4-;; |
| InChIKey | HDUWFDFLZKEGKD-QSELPZCXSA-N |
| XLogP | 7.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |