C26H31N9O2 — CID 143758309
3-amino-N-[(5-carbamimidoylcyclohepta-1,3,6-trien-1-yl)methyl]-6-[(4-carbamimidoylphenyl)methylamino]-5-(1-hydroxybut-1-enyl)pyrazine-2-carboxamide (PubChem CID 143758309) has the molecular formula C26H31N9O2 and a molecular weight of 501.60 g/mol. Its IUPAC name is 3-amino-N-[(5-carbamimidoylcyclohepta-1,3,6-trien-1-yl)methyl]-6-[(4-carbamimidoylphenyl)methylamino]-5-(1-hydroxybut-1-enyl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-N-[(5-carbamimidoylcyclohepta-1,3,6-trien-1-yl)methyl]-6-[(4-carbamimidoylphenyl)methylamino]-5-(1-hydroxybut-1-enyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 143758309 |
| Molecular Formula | C26H31N9O2 |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.26 |
| IUPAC Name | 3-amino-N-[(5-carbamimidoylcyclohepta-1,3,6-trien-1-yl)methyl]-6-[(4-carbamimidoylphenyl)methylamino]-5-(1-hydroxybut-1-enyl)pyrazine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNc2nc(C(=O)NCC3=CC=CC(/C(N)=N/[H])C=C3)c(N)nc2C(O)=CCC)cc1 |
| InChI | InChI=1S/C26H31N9O2/c1-2-4-19(36)20-25(32-13-16-8-11-18(12-9-16)23(29)30)35-21(24(31)34-20)26(37)33-14-15-5-3-6-17(10-7-15)22(27)28/h3-12,17,36H,2,13-14H2,1H3,(H3,27,28)(H3,29,30)(H2,31,34)(H,32,35)(H,33,37) |
| InChIKey | RSDLMLTYAJQZHB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 212.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|