C25H32N8O4 — CID 143758307
3-[(4-carbamimidoylphenyl)methylamino]-6-[[(3Z,5E)-5-methanimidoyl-2-methylideneocta-3,5-dienyl]amino]pyrazine-2,5-dicarboxylic acid;methanamine (PubChem CID 143758307) has the molecular formula C25H32N8O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is 3-[(4-carbamimidoylphenyl)methylamino]-6-[[(3Z,5E)-5-methanimidoyl-2-methylideneocta-3,5-dienyl]amino]pyrazine-2,5-dicarboxylic acid;methanamine.
| Compound Name | 3-[(4-carbamimidoylphenyl)methylamino]-6-[[(3Z,5E)-5-methanimidoyl-2-methylideneocta-3,5-dienyl]amino]pyrazine-2,5-dicarboxylic acid;methanamine |
|---|---|
| PubChem CID | 143758307 |
| Molecular Formula | C25H32N8O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-[(4-carbamimidoylphenyl)methylamino]-6-[[(3Z,5E)-5-methanimidoyl-2-methylideneocta-3,5-dienyl]amino]pyrazine-2,5-dicarboxylic acid;methanamine |
| SMILES | CN.[H]/N=C(\N)c1ccc(CNc2nc(C(=O)O)c(NCC(=C)/C=C\C(\C=N\[H])=C/CC)nc2C(=O)O)cc1 |
| InChI | InChI=1S/C24H27N7O4.CH5N/c1-3-4-15(11-25)6-5-14(2)12-28-21-18(23(32)33)31-22(19(30-21)24(34)35)29-13-16-7-9-17(10-8-16)20(26)27;1-2/h4-11,25H,2-3,12-13H2,1H3,(H3,26,27)(H,28,30)(H,29,31)(H,32,33)(H,34,35);2H2,1H3/b6-5-,15-4+,25-11+; |
| InChIKey | NSYRZSGNMOFOPD-HCDYFPJCSA-N |
| XLogP | 2.85 |
| TPSA | 224.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|