C58H53B — CID 143759683
[4-[2-methyl-3-(2-propylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]-[4-[(2E,4E)-5-phenylhexa-2,4-dien-2-yl]phenyl]-[4-(4-phenylphenyl)phenyl]borane (PubChem CID 143759683) has the molecular formula C58H53B and a molecular weight of 760.87 g/mol. Its IUPAC name is [4-[2-methyl-3-(2-propylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]-[4-[(2E,4E)-5-phenylhexa-2,4-dien-2-yl]phenyl]-[4-(4-phenylphenyl)phenyl]borane.
| Compound Name | [4-[2-methyl-3-(2-propylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]-[4-[(2E,4E)-5-phenylhexa-2,4-dien-2-yl]phenyl]-[4-(4-phenylphenyl)phenyl]borane |
|---|---|
| PubChem CID | 143759683 |
| Molecular Formula | C58H53B |
| Molecular Weight | 760.87 g/mol |
| Exact Mass | 760.42 |
| IUPAC Name | [4-[2-methyl-3-(2-propylcyclohexa-1,3-dien-1-yl)phenyl]phenyl]-[4-[(2E,4E)-5-phenylhexa-2,4-dien-2-yl]phenyl]-[4-(4-phenylphenyl)phenyl]borane |
| SMILES | CCCC1=C(c2cccc(-c3ccc(B(c4ccc(/C(C)=C/C=C(\C)c5ccccc5)cc4)c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)cc3)c2C)CCC=C1 |
| InChI | InChI=1S/C58H53B/c1-5-15-51-20-12-13-21-58(51)57-23-14-22-56(44(57)4)52-34-40-55(41-35-52)59(53-36-30-46(31-37-53)43(3)25-24-42(2)45-16-8-6-9-17-45)54-38-32-50(33-39-54)49-28-26-48(27-29-49)47-18-10-7-11-19-47/h6-12,14,16-20,22-41H,5,13,15,21H2,1-4H3/b42-24+,43-25+ |
| InChIKey | ZKFLQWNKGGZYCP-FFVIWPAXSA-N |
| XLogP | 13.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.87 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|