C8H14N2 — CID 143760171
N'-methyl-N-penta-1,4-dien-2-ylethanimidamide (PubChem CID 143760171) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is N'-methyl-N-penta-1,4-dien-2-ylethanimidamide.
| Compound Name | N'-methyl-N-penta-1,4-dien-2-ylethanimidamide |
|---|---|
| PubChem CID | 143760171 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N'-methyl-N-penta-1,4-dien-2-ylethanimidamide |
| SMILES | C=CCC(=C)N/C(C)=N/C |
| InChI | InChI=1S/C8H14N2/c1-5-6-7(2)10-8(3)9-4/h5H,1-2,6H2,3-4H3,(H,9,10) |
| InChIKey | FGHYISGOKLEXGX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|