C18H21F3N2O5 — CID 143760557
N-[[3-[4-[(1S)-3,4-dihydroxycyclohexyl]-2,3,5-trifluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 143760557) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is N-[[3-[4-[(1S)-3,4-dihydroxycyclohexyl]-2,3,5-trifluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(1S)-3,4-dihydroxycyclohexyl]-2,3,5-trifluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 143760557 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | N-[[3-[4-[(1S)-3,4-dihydroxycyclohexyl]-2,3,5-trifluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2cc(F)c([C@H]3CCC(O)C(O)C3)c(F)c2F)C(=O)O1 |
| InChI | InChI=1S/C18H21F3N2O5/c1-8(24)22-6-10-7-23(18(27)28-10)12-5-11(19)15(17(21)16(12)20)9-2-3-13(25)14(26)4-9/h5,9-10,13-14,25-26H,2-4,6-7H2,1H3,(H,22,24)/t9-,10?,13?,14?/m0/s1 |
| InChIKey | AUHZNMAATIYHKJ-CBWZGZIKSA-N |
| XLogP | 1.55 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|