C19H20O2S — CID 143762582
3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1-benzothiophene-5-carboxylic acid (PubChem CID 143762582) has the molecular formula C19H20O2S and a molecular weight of 312.43 g/mol. Its IUPAC name is 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1-benzothiophene-5-carboxylic acid.
| Compound Name | 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1-benzothiophene-5-carboxylic acid |
|---|---|
| PubChem CID | 143762582 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 3-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1-benzothiophene-5-carboxylic acid |
| SMILES | C/C=C\C(=C/C=C(\C)CC)c1csc2ccc(C(=O)O)cc12 |
| InChI | InChI=1S/C19H20O2S/c1-4-6-14(8-7-13(3)5-2)17-12-22-18-10-9-15(19(20)21)11-16(17)18/h4,6-12H,5H2,1-3H3,(H,20,21)/b6-4-,13-7+,14-8+ |
| InChIKey | XFNBXOUVPGFXGL-ULQNLPGHSA-N |
| XLogP | 5.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|