C8H8F5NO — CID 143764486
(3Z)-5-(1,1,2,2,2-pentafluoroethoxy)hexa-1,3,5-trien-2-amine (PubChem CID 143764486) has the molecular formula C8H8F5NO and a molecular weight of 229.15 g/mol. Its IUPAC name is (3Z)-5-(1,1,2,2,2-pentafluoroethoxy)hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-(1,1,2,2,2-pentafluoroethoxy)hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143764486 |
| Molecular Formula | C8H8F5NO |
| Molecular Weight | 229.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (3Z)-5-(1,1,2,2,2-pentafluoroethoxy)hexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C(=C)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H8F5NO/c1-5(14)3-4-6(2)15-8(12,13)7(9,10)11/h3-4H,1-2,14H2/b4-3- |
| InChIKey | GWTPXLTVLKGRCJ-ARJAWSKDSA-N |
| XLogP | 2.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.15 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|