C8H12FNO — CID 89074120
(2E,4E)-5-fluoro-6-methoxyhepta-2,4,6-trien-3-amine (PubChem CID 89074120) has the molecular formula C8H12FNO and a molecular weight of 157.19 g/mol. Its IUPAC name is (2E,4E)-5-fluoro-6-methoxyhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4E)-5-fluoro-6-methoxyhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 89074120 |
| Molecular Formula | C8H12FNO |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | (2E,4E)-5-fluoro-6-methoxyhepta-2,4,6-trien-3-amine |
| SMILES | C=C(OC)/C(F)=C\C(N)=C/C |
| InChI | InChI=1S/C8H12FNO/c1-4-7(10)5-8(9)6(2)11-3/h4-5H,2,10H2,1,3H3/b7-4+,8-5+ |
| InChIKey | KKXZWALVQJWDMG-NSLJXJERSA-N |
| XLogP | 1.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|