C12H16N2O — CID 145488217
(3Z)-5-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-amine (PubChem CID 145488217) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is (3Z)-5-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-5-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 145488217 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | (3Z)-5-[(3Z)-5-aminohexa-1,3,5-trien-2-yl]oxyhexa-1,3,5-trien-2-amine |
| SMILES | C=C(N)/C=C\C(=C)OC(=C)/C=C\C(=C)N |
| InChI | InChI=1S/C12H16N2O/c1-9(13)5-7-11(3)15-12(4)8-6-10(2)14/h5-8H,1-4,13-14H2/b7-5-,8-6- |
| InChIKey | PBWUGVGYLMRJCM-SFECMWDFSA-N |
| XLogP | 2.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|