C9H15NO — CID 134174760
(2E,4Z)-6-ethoxyhepta-2,4,6-trien-3-amine (PubChem CID 134174760) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (2E,4Z)-6-ethoxyhepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-6-ethoxyhepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 134174760 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (2E,4Z)-6-ethoxyhepta-2,4,6-trien-3-amine |
| SMILES | C=C(/C=C\C(N)=C/C)OCC |
| InChI | InChI=1S/C9H15NO/c1-4-9(10)7-6-8(3)11-5-2/h4,6-7H,3,5,10H2,1-2H3/b7-6-,9-4+ |
| InChIKey | ZJFOJBGDNXQITB-WSISTYIOSA-N |
| XLogP | 1.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|