C31H29NO3S — CID 143764494
13-cyclohexyl-3-methoxy-6-(2-sulfanylphenyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid (PubChem CID 143764494) has the molecular formula C31H29NO3S and a molecular weight of 495.64 g/mol. Its IUPAC name is 13-cyclohexyl-3-methoxy-6-(2-sulfanylphenyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid.
| Compound Name | 13-cyclohexyl-3-methoxy-6-(2-sulfanylphenyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 143764494 |
| Molecular Formula | C31H29NO3S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | 13-cyclohexyl-3-methoxy-6-(2-sulfanylphenyl)-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(c1ccccc1S)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C31H29NO3S/c1-35-23-12-14-25-21(16-23)15-22(24-9-5-6-10-28(24)36)18-32-27-17-20(31(33)34)11-13-26(27)29(30(25)32)19-7-3-2-4-8-19/h5-6,9-17,19,36H,2-4,7-8,18H2,1H3,(H,33,34) |
| InChIKey | DTPFCSOWIUNXNK-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|