C35H34N2O4 — CID 25190007
13-cyclohexyl-6-[2-(cyclopropanecarbonylamino)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid (PubChem CID 25190007) has the molecular formula C35H34N2O4 and a molecular weight of 546.67 g/mol. Its IUPAC name is 13-cyclohexyl-6-[2-(cyclopropanecarbonylamino)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid.
| Compound Name | 13-cyclohexyl-6-[2-(cyclopropanecarbonylamino)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 25190007 |
| Molecular Formula | C35H34N2O4 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | 13-cyclohexyl-6-[2-(cyclopropanecarbonylamino)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(c1ccccc1NC(=O)C1CC1)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C35H34N2O4/c1-41-26-14-16-28-24(18-26)17-25(27-9-5-6-10-30(27)36-34(38)22-11-12-22)20-37-31-19-23(35(39)40)13-15-29(31)32(33(28)37)21-7-3-2-4-8-21/h5-6,9-10,13-19,21-22H,2-4,7-8,11-12,20H2,1H3,(H,36,38)(H,39,40) |
| InChIKey | JDPXTCMNEQJZIY-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|