C32H27F4NO3 — CID 25190011
13-cyclohexyl-6-[2-fluoro-6-(trifluoromethyl)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid (PubChem CID 25190011) has the molecular formula C32H27F4NO3 and a molecular weight of 549.56 g/mol. Its IUPAC name is 13-cyclohexyl-6-[2-fluoro-6-(trifluoromethyl)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid.
| Compound Name | 13-cyclohexyl-6-[2-fluoro-6-(trifluoromethyl)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
|---|---|
| PubChem CID | 25190011 |
| Molecular Formula | C32H27F4NO3 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.19 |
| IUPAC Name | 13-cyclohexyl-6-[2-fluoro-6-(trifluoromethyl)phenyl]-3-methoxy-7H-indolo[2,1-a][2]benzazepine-10-carboxylic acid |
| SMILES | COc1ccc2c(c1)C=C(c1c(F)cccc1C(F)(F)F)Cn1c-2c(C2CCCCC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C32H27F4NO3/c1-40-22-11-13-23-20(15-22)14-21(29-25(32(34,35)36)8-5-9-26(29)33)17-37-27-16-19(31(38)39)10-12-24(27)28(30(23)37)18-6-3-2-4-7-18/h5,8-16,18H,2-4,6-7,17H2,1H3,(H,38,39) |
| InChIKey | ASXQRXUKCALYMH-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|