C21H24N6O3 — CID 143764994
6-nitroso-7-[3-(4-pyridin-2-ylpiperazin-1-yl)propylamino]quinoline-5,8-diol (PubChem CID 143764994) has the molecular formula C21H24N6O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 6-nitroso-7-[3-(4-pyridin-2-ylpiperazin-1-yl)propylamino]quinoline-5,8-diol.
| Compound Name | 6-nitroso-7-[3-(4-pyridin-2-ylpiperazin-1-yl)propylamino]quinoline-5,8-diol |
|---|---|
| PubChem CID | 143764994 |
| Molecular Formula | C21H24N6O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 6-nitroso-7-[3-(4-pyridin-2-ylpiperazin-1-yl)propylamino]quinoline-5,8-diol |
| SMILES | O=Nc1c(NCCCN2CCN(c3ccccn3)CC2)c(O)c2ncccc2c1O |
| InChI | InChI=1S/C21H24N6O3/c28-20-15-5-3-8-23-17(15)21(29)18(19(20)25-30)24-9-4-10-26-11-13-27(14-12-26)16-6-1-2-7-22-16/h1-3,5-8,24,28-29H,4,9-14H2 |
| InChIKey | YMBNEOVAXBNXLV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|