C32H46N4O4 — CID 143769542
4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-3-methylbutyl]-3-oxoquinoxaline-2-carboxamide (PubChem CID 143769542) has the molecular formula C32H46N4O4 and a molecular weight of 550.74 g/mol. Its IUPAC name is 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-3-methylbutyl]-3-oxoquinoxaline-2-carboxamide.
| Compound Name | 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-3-methylbutyl]-3-oxoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 143769542 |
| Molecular Formula | C32H46N4O4 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 4-[(1R,5S)-8-cyclooctyl-8-azabicyclo[3.2.1]octan-3-yl]-N-[1-(3-methoxyoxiran-2-yl)-3-methylbutyl]-3-oxoquinoxaline-2-carboxamide |
| SMILES | COC1OC1C(CC(C)C)NC(=O)c1nc2ccccc2n(C2C[C@H]3CC[C@@H](C2)N3C2CCCCCCC2)c1=O |
| InChI | InChI=1S/C32H46N4O4/c1-20(2)17-26(29-32(39-3)40-29)34-30(37)28-31(38)36(27-14-10-9-13-25(27)33-28)24-18-22-15-16-23(19-24)35(22)21-11-7-5-4-6-8-12-21/h9-10,13-14,20-24,26,29,32H,4-8,11-12,15-19H2,1-3H3,(H,34,37)/t22-,23+,24?,26?,29?,32? |
| InChIKey | CSOBFHOTEGTHSR-MNNYOCPYSA-N |
| XLogP | 5.19 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|