C26H37N3O3 — CID 143769590
4-[(1R,5R)-5-ethenyl-3,3-dimethylcyclohexyl]-3-oxoquinoxaline-2-carboxylic acid;(Z)-hept-2-en-1-amine (PubChem CID 143769590) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 4-[(1R,5R)-5-ethenyl-3,3-dimethylcyclohexyl]-3-oxoquinoxaline-2-carboxylic acid;(Z)-hept-2-en-1-amine.
| Compound Name | 4-[(1R,5R)-5-ethenyl-3,3-dimethylcyclohexyl]-3-oxoquinoxaline-2-carboxylic acid;(Z)-hept-2-en-1-amine |
|---|---|
| PubChem CID | 143769590 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 4-[(1R,5R)-5-ethenyl-3,3-dimethylcyclohexyl]-3-oxoquinoxaline-2-carboxylic acid;(Z)-hept-2-en-1-amine |
| SMILES | C=C[C@H]1C[C@@H](n2c(=O)c(C(=O)O)nc3ccccc32)CC(C)(C)C1.CCCC/C=C\CN |
| InChI | InChI=1S/C19H22N2O3.C7H15N/c1-4-12-9-13(11-19(2,3)10-12)21-15-8-6-5-7-14(15)20-16(17(21)22)18(23)24;1-2-3-4-5-6-7-8/h4-8,12-13H,1,9-11H2,2-3H3,(H,23,24);5-6H,2-4,7-8H2,1H3/b;6-5-/t12-,13+;/m0./s1 |
| InChIKey | XMDHGQWOSDIKNQ-SOQIVQLSSA-N |
| XLogP | 5.34 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|