C25H33N3O3 — CID 154500556
4-[1-[(5R)-3,5-diethyl-1-methylcyclohex-2-en-1-yl]piperidin-4-yl]-3-oxoquinoxaline-2-carboxylic acid (PubChem CID 154500556) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 4-[1-[(5R)-3,5-diethyl-1-methylcyclohex-2-en-1-yl]piperidin-4-yl]-3-oxoquinoxaline-2-carboxylic acid.
| Compound Name | 4-[1-[(5R)-3,5-diethyl-1-methylcyclohex-2-en-1-yl]piperidin-4-yl]-3-oxoquinoxaline-2-carboxylic acid |
|---|---|
| PubChem CID | 154500556 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 4-[1-[(5R)-3,5-diethyl-1-methylcyclohex-2-en-1-yl]piperidin-4-yl]-3-oxoquinoxaline-2-carboxylic acid |
| SMILES | CCC1=CC(C)(N2CCC(n3c(=O)c(C(=O)O)nc4ccccc43)CC2)C[C@H](CC)C1 |
| InChI | InChI=1S/C25H33N3O3/c1-4-17-14-18(5-2)16-25(3,15-17)27-12-10-19(11-13-27)28-21-9-7-6-8-20(21)26-22(23(28)29)24(30)31/h6-9,15,18-19H,4-5,10-14,16H2,1-3H3,(H,30,31)/t18-,25?/m1/s1 |
| InChIKey | GEVDMWQEOGCSSX-YDONVPIESA-N |
| XLogP | 4.65 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|