C28H34F4O — CID 143772992
(2Z,6Z,10Z,14Z)-6,7,14,15-tetrafluoro-5,8,9,12,13,16-hexamethylidene-17-(2-methylpropoxy)octadeca-2,6,10,14-tetraene (PubChem CID 143772992) has the molecular formula C28H34F4O and a molecular weight of 462.57 g/mol. Its IUPAC name is (2Z,6Z,10Z,14Z)-6,7,14,15-tetrafluoro-5,8,9,12,13,16-hexamethylidene-17-(2-methylpropoxy)octadeca-2,6,10,14-tetraene.
| Compound Name | (2Z,6Z,10Z,14Z)-6,7,14,15-tetrafluoro-5,8,9,12,13,16-hexamethylidene-17-(2-methylpropoxy)octadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 143772992 |
| Molecular Formula | C28H34F4O |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (2Z,6Z,10Z,14Z)-6,7,14,15-tetrafluoro-5,8,9,12,13,16-hexamethylidene-17-(2-methylpropoxy)octadeca-2,6,10,14-tetraene |
| SMILES | C=C(/C=C/C(=C)C(=C)/C(F)=C(\F)C(=C)C/C=C\C)C(=C)/C(F)=C(/F)C(=C)C(C)OCC(C)C |
| InChI | InChI=1S/C28H34F4O/c1-11-12-13-20(6)25(29)26(30)21(7)18(4)14-15-19(5)22(8)27(31)28(32)23(9)24(10)33-16-17(2)3/h11-12,14-15,17,24H,4-9,13,16H2,1-3,10H3/b12-11-,15-14-,26-25-,28-27- |
| InChIKey | RPLHRBUUNPLJOT-BQXNSQBPSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|