C21H35F3O — CID 143367930
(Z)-4-methoxypent-2-ene;(E)-4-methylpent-2-ene;(3Z,5E)-8,8,8-trifluoro-6-methylocta-1,3,5-triene (PubChem CID 143367930) has the molecular formula C21H35F3O and a molecular weight of 360.50 g/mol. Its IUPAC name is (Z)-4-methoxypent-2-ene;(E)-4-methylpent-2-ene;(3Z,5E)-8,8,8-trifluoro-6-methylocta-1,3,5-triene.
| Compound Name | (Z)-4-methoxypent-2-ene;(E)-4-methylpent-2-ene;(3Z,5E)-8,8,8-trifluoro-6-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 143367930 |
| Molecular Formula | C21H35F3O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (Z)-4-methoxypent-2-ene;(E)-4-methylpent-2-ene;(3Z,5E)-8,8,8-trifluoro-6-methylocta-1,3,5-triene |
| SMILES | C/C=C/C(C)C.C/C=C\C(C)OC.C=C/C=C\C=C(/C)CC(F)(F)F |
| InChI | InChI=1S/C9H11F3.C6H12O.C6H12/c1-3-4-5-6-8(2)7-9(10,11)12;1-4-5-6(2)7-3;1-4-5-6(2)3/h3-6H,1,7H2,2H3;4-6H,1-3H3;4-6H,1-3H3/b5-4-,8-6+;5-4-;5-4+ |
| InChIKey | JXYNLMJOFXSZJH-WDRNBPELSA-N |
| XLogP | 7.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|