C18H20F6O — CID 143238963
3-[[(3E,5E)-4,6-difluoro-5-methylocta-3,5-dien-2-yl]oxy-difluoromethyl]-2,4-difluoro-7-methylcyclohepta-1,3,5-triene (PubChem CID 143238963) has the molecular formula C18H20F6O and a molecular weight of 366.35 g/mol. Its IUPAC name is 3-[[(3E,5E)-4,6-difluoro-5-methylocta-3,5-dien-2-yl]oxy-difluoromethyl]-2,4-difluoro-7-methylcyclohepta-1,3,5-triene.
| Compound Name | 3-[[(3E,5E)-4,6-difluoro-5-methylocta-3,5-dien-2-yl]oxy-difluoromethyl]-2,4-difluoro-7-methylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143238963 |
| Molecular Formula | C18H20F6O |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[[(3E,5E)-4,6-difluoro-5-methylocta-3,5-dien-2-yl]oxy-difluoromethyl]-2,4-difluoro-7-methylcyclohepta-1,3,5-triene |
| SMILES | CC/C(F)=C(C)\C(F)=C/C(C)OC(F)(F)C1=C(F)C=CC(C)C=C1F |
| InChI | InChI=1S/C18H20F6O/c1-5-13(19)12(4)15(21)9-11(3)25-18(23,24)17-14(20)7-6-10(2)8-16(17)22/h6-11H,5H2,1-4H3/b13-12+,15-9+ |
| InChIKey | AFLULNWHIGHCLZ-XSICDGKGSA-N |
| XLogP | 6.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|