C25H31F3O — CID 143773066
(3Z,7Z,11E)-3,4,11-trifluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene (PubChem CID 143773066) has the molecular formula C25H31F3O and a molecular weight of 404.52 g/mol. Its IUPAC name is (3Z,7Z,11E)-3,4,11-trifluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene.
| Compound Name | (3Z,7Z,11E)-3,4,11-trifluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene |
|---|---|
| PubChem CID | 143773066 |
| Molecular Formula | C25H31F3O |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (3Z,7Z,11E)-3,4,11-trifluoro-2-methyl-5,6,9,10,13-pentamethylidene-14-(2-methylpropoxy)pentadeca-1,3,7,11-tetraene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C(F)=C\C(=C)C(C)OCC(C)C)C(=C)/C(F)=C(/F)C(=C)C |
| InChI | InChI=1S/C25H31F3O/c1-15(2)14-29-22(10)19(7)13-23(26)20(8)17(5)11-12-18(6)21(9)25(28)24(27)16(3)4/h11-13,15,22H,3,5-9,14H2,1-2,4,10H3/b12-11-,23-13+,25-24- |
| InChIKey | ISBHJTAOBLWFQE-DBKBYEBWSA-N |
| XLogP | 7.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|