C32H35FN2O3S — CID 143773437
(3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one;2-methylsulfinylpropane (PubChem CID 143773437) has the molecular formula C32H35FN2O3S and a molecular weight of 546.71 g/mol. Its IUPAC name is (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one;2-methylsulfinylpropane.
| Compound Name | (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one;2-methylsulfinylpropane |
|---|---|
| PubChem CID | 143773437 |
| Molecular Formula | C32H35FN2O3S |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one;2-methylsulfinylpropane |
| SMILES | C/C=C\C=C(/C(C)=O)c1c(C(C)=O)n(Cc2cc3ccccc3nc2C)c2cc(F)ccc12.CC(C)S(C)=O |
| InChI | InChI=1S/C28H25FN2O2.C4H10OS/c1-5-6-10-23(18(3)32)27-24-13-12-22(29)15-26(24)31(28(27)19(4)33)16-21-14-20-9-7-8-11-25(20)30-17(21)2;1-4(2)6(3)5/h5-15H,16H2,1-4H3;4H,1-3H3/b6-5-,23-10+; |
| InChIKey | ZFXVWLQXNJYFPN-SJQSUHOISA-N |
| XLogP | 7.21 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|