C28H25FN2O2 — CID 143773438
(3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one (PubChem CID 143773438) has the molecular formula C28H25FN2O2 and a molecular weight of 440.52 g/mol. Its IUPAC name is (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one.
| Compound Name | (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one |
|---|---|
| PubChem CID | 143773438 |
| Molecular Formula | C28H25FN2O2 |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | (3Z,5Z)-3-[2-acetyl-6-fluoro-1-[(2-methylquinolin-3-yl)methyl]indol-3-yl]hepta-3,5-dien-2-one |
| SMILES | C/C=C\C=C(/C(C)=O)c1c(C(C)=O)n(Cc2cc3ccccc3nc2C)c2cc(F)ccc12 |
| InChI | InChI=1S/C28H25FN2O2/c1-5-6-10-23(18(3)32)27-24-13-12-22(29)15-26(24)31(28(27)19(4)33)16-21-14-20-9-7-8-11-25(20)30-17(21)2/h5-15H,16H2,1-4H3/b6-5-,23-10+ |
| InChIKey | FKHDWKNEFRAOIU-XXRPSCECSA-N |
| XLogP | 6.44 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|