C11H24N2 — CID 143774568
2-N-[(Z)-but-2-en-2-yl]propane-1,2-diimine;ethane (PubChem CID 143774568) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 2-N-[(Z)-but-2-en-2-yl]propane-1,2-diimine;ethane.
| Compound Name | 2-N-[(Z)-but-2-en-2-yl]propane-1,2-diimine;ethane |
|---|---|
| PubChem CID | 143774568 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 2-N-[(Z)-but-2-en-2-yl]propane-1,2-diimine;ethane |
| SMILES | CC.CC.[H]/N=C/C(C)=N/C(C)=C\C |
| InChI | InChI=1S/C7H12N2.2C2H6/c1-4-6(2)9-7(3)5-8;2*1-2/h4-5,8H,1-3H3;2*1-2H3/b6-4-,8-5+,9-7+;; |
| InChIKey | UVJAWAGXODOIOM-JDUKNUOKSA-N |
| XLogP | 4.07 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|