About ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol
ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol (PubChem CID 143774627) has the molecular formula C20H37F5OS
and a molecular weight of 420.57 g/mol. Its IUPAC name is ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol.
Molecular Properties
| Compound Name | ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol |
| PubChem CID | 143774627 |
| Molecular Formula | C20H37F5OS |
| Molecular Weight | 420.57 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol |
| SMILES | CC.CC(CO)c1ccc(S(F)(F)(F)(F)F)cc1.CCCCCCCCC |
| InChI | InChI=1S/C9H11F5OS.C9H20.C2H6/c1-7(6-15)8-2-4-9(5-3-8)16(10,11,12,13)14;1-3-5-7-9-8-6-4-2;1-2/h2-5,7,15H,6H2,1H3;3-9H2,1-2H3;1-2H3 |
| InChIKey | GSGJPGYWLNKIEW-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.57 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol?
The IUPAC name of ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol (CID 143774627) is ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol.
What is the SMILES notation for ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol?
The canonical SMILES for ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol is CC.CC(CO)c1ccc(S(F)(F)(F)(F)F)cc1.CCCCCCCCC.
What is the InChIKey of ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol?
The InChIKey is GSGJPGYWLNKIEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F5OS.C9H20.C2H6/c1-7(6-15)8-2-4-9(5-3-8)16(10,11,12,13)14;1-3-5-7-9-8-6-4-2;1-2/h2-5,7,15H,6H2,1H3;3-9H2,1-2H3;1-2H3.
What are the key properties of ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol?
ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol has a molecular weight of 420.57 g/mol, XLogP of 9.22, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;nonane;2-[4-(pentafluoro-λ6-sulfanyl)phenyl]propan-1-ol is sourced from PubChem (CID 143774627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).