C22H33N3O4 — CID 143776672
2-[4-[(3R)-3-[1-[(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]butoxy]phenyl]acetic acid (PubChem CID 143776672) has the molecular formula C22H33N3O4 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[4-[(3R)-3-[1-[(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]butoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[(3R)-3-[1-[(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]butoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 143776672 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | 2-[4-[(3R)-3-[1-[(1-amino-2-methylpropylidene)carbamoyl]piperidin-4-yl]butoxy]phenyl]acetic acid |
| SMILES | CC(C)C(N)=NC(=O)N1CCC([C@H](C)CCOc2ccc(CC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O4/c1-15(2)21(23)24-22(28)25-11-8-18(9-12-25)16(3)10-13-29-19-6-4-17(5-7-19)14-20(26)27/h4-7,15-16,18H,8-14H2,1-3H3,(H,26,27)(H2,23,24,28)/t16-/m1/s1 |
| InChIKey | VFYATISKSPBYLQ-MRXNPFEDSA-N |
| XLogP | 3.56 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|