C23H34N3O4- — CID 159598022
[1-[[4-[(2R)-4-[4-[(1S)-1-carboxyethyl]phenoxy]butan-2-yl]piperidine-1-carbonyl]amino]-2-methylpropylidene]azanide (PubChem CID 159598022) has the molecular formula C23H34N3O4- and a molecular weight of 416.54 g/mol. Its IUPAC name is [1-[[4-[(2R)-4-[4-[(1S)-1-carboxyethyl]phenoxy]butan-2-yl]piperidine-1-carbonyl]amino]-2-methylpropylidene]azanide.
| Compound Name | [1-[[4-[(2R)-4-[4-[(1S)-1-carboxyethyl]phenoxy]butan-2-yl]piperidine-1-carbonyl]amino]-2-methylpropylidene]azanide |
|---|---|
| PubChem CID | 159598022 |
| Molecular Formula | C23H34N3O4- |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | [1-[[4-[(2R)-4-[4-[(1S)-1-carboxyethyl]phenoxy]butan-2-yl]piperidine-1-carbonyl]amino]-2-methylpropylidene]azanide |
| SMILES | CC(C)C(=[N-])NC(=O)N1CCC([C@H](C)CCOc2ccc([C@H](C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C23H34N3O4/c1-15(2)21(24)25-23(29)26-12-9-18(10-13-26)16(3)11-14-30-20-7-5-19(6-8-20)17(4)22(27)28/h5-8,15-18H,9-14H2,1-4H3,(H2-,24,25,27,28,29)/q-1/t16-,17+/m1/s1 |
| InChIKey | MLCIMJPIHKDSOY-SJORKVTESA-N |
| XLogP | 4.33 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|