C20H31BrN4O2 — CID 91358903
N-(1-amino-2-methylpropylidene)-4-[4-[(6-bromo-5-methyl-3-pyridinyl)oxy]butan-2-yl]piperidine-1-carboxamide (PubChem CID 91358903) has the molecular formula C20H31BrN4O2 and a molecular weight of 439.40 g/mol. Its IUPAC name is N-(1-amino-2-methylpropylidene)-4-[4-[(6-bromo-5-methyl-3-pyridinyl)oxy]butan-2-yl]piperidine-1-carboxamide.
| Compound Name | N-(1-amino-2-methylpropylidene)-4-[4-[(6-bromo-5-methyl-3-pyridinyl)oxy]butan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91358903 |
| Molecular Formula | C20H31BrN4O2 |
| Molecular Weight | 439.40 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-(1-amino-2-methylpropylidene)-4-[4-[(6-bromo-5-methyl-3-pyridinyl)oxy]butan-2-yl]piperidine-1-carboxamide |
| SMILES | Cc1cc(OCCC(C)C2CCN(C(=O)N=C(N)C(C)C)CC2)cnc1Br |
| InChI | InChI=1S/C20H31BrN4O2/c1-13(2)19(22)24-20(26)25-8-5-16(6-9-25)14(3)7-10-27-17-11-15(4)18(21)23-12-17/h11-14,16H,5-10H2,1-4H3,(H2,22,24,26) |
| InChIKey | XAQLNSLAKUMLCE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|