C27H36F3N7O2 — CID 91547795
N-(1-aminopropylidene)-4-[4-[2-[3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxybutan-2-yl]piperidine-1-carboxamide (PubChem CID 91547795) has the molecular formula C27H36F3N7O2 and a molecular weight of 547.63 g/mol. Its IUPAC name is N-(1-aminopropylidene)-4-[4-[2-[3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxybutan-2-yl]piperidine-1-carboxamide.
| Compound Name | N-(1-aminopropylidene)-4-[4-[2-[3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxybutan-2-yl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91547795 |
| Molecular Formula | C27H36F3N7O2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | N-(1-aminopropylidene)-4-[4-[2-[3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxybutan-2-yl]piperidine-1-carboxamide |
| SMILES | CCC(N)=NC(=O)N1CCC(C(C)CCOc2cnc(N3CC(N)C(c4cc(F)c(F)cc4F)C3)nc2)CC1 |
| InChI | InChI=1S/C27H36F3N7O2/c1-3-25(32)35-27(38)36-7-4-17(5-8-36)16(2)6-9-39-18-12-33-26(34-13-18)37-14-20(24(31)15-37)19-10-22(29)23(30)11-21(19)28/h10-13,16-17,20,24H,3-9,14-15,31H2,1-2H3,(H2,32,35,38) |
| InChIKey | YMTHGFATMGETCZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|