C27H35ClF3N7O2 — CID 162333655
(3R,4S)-1-[5-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;hydrochloride (PubChem CID 162333655) has the molecular formula C27H35ClF3N7O2 and a molecular weight of 582.07 g/mol. Its IUPAC name is (3R,4S)-1-[5-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R,4S)-1-[5-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 162333655 |
| Molecular Formula | C27H35ClF3N7O2 |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | (3R,4S)-1-[5-[3-[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]propoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine;hydrochloride |
| SMILES | CC(C)c1noc(N2CCC(CCCOc3cnc(N4C[C@H](c5cc(F)c(F)cc5F)[C@@H](N)C4)nc3)CC2)n1.Cl |
| InChI | InChI=1S/C27H34F3N7O2.ClH/c1-16(2)25-34-27(39-35-25)36-7-5-17(6-8-36)4-3-9-38-18-12-32-26(33-13-18)37-14-20(24(31)15-37)19-10-22(29)23(30)11-21(19)28;/h10-13,16-17,20,24H,3-9,14-15,31H2,1-2H3;1H/t20-,24+;/m1./s1 |
| InChIKey | YNAQQKZIIIQZTQ-UFZJIDKFSA-N |
| XLogP | 4.83 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|