C27H34F3N7O2 — CID 46913701
(3S,4R)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 46913701) has the molecular formula C27H34F3N7O2 and a molecular weight of 545.61 g/mol. Its IUPAC name is (3S,4R)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 46913701 |
| Molecular Formula | C27H34F3N7O2 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | (3S,4R)-1-[5-[(3R)-3-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]butoxy]pyrimidin-2-yl]-4-(2,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | CCc1noc(N2CCC([C@H](C)CCOc3cnc(N4C[C@@H](N)[C@H](c5cc(F)c(F)cc5F)C4)nc3)CC2)n1 |
| InChI | InChI=1S/C27H34F3N7O2/c1-3-25-34-27(39-35-25)36-7-4-17(5-8-36)16(2)6-9-38-18-12-32-26(33-13-18)37-14-20(24(31)15-37)19-10-22(29)23(30)11-21(19)28/h10-13,16-17,20,24H,3-9,14-15,31H2,1-2H3/t16-,20+,24-/m1/s1 |
| InChIKey | UBKKPLJBCFVYIV-AAORUROXSA-N |
| XLogP | 4.09 |
| TPSA | 106.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|