C27H33ClF3N7O3 — CID 66693344
1-[5-[4-[(1S)-1-[2-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxyethyl]piperidin-1-yl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-ol;hydrochloride (PubChem CID 66693344) has the molecular formula C27H33ClF3N7O3 and a molecular weight of 596.05 g/mol. Its IUPAC name is 1-[5-[4-[(1S)-1-[2-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxyethyl]piperidin-1-yl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-ol;hydrochloride.
| Compound Name | 1-[5-[4-[(1S)-1-[2-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxyethyl]piperidin-1-yl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 66693344 |
| Molecular Formula | C27H33ClF3N7O3 |
| Molecular Weight | 596.05 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | 1-[5-[4-[(1S)-1-[2-[(3R,4S)-3-amino-4-(2,4,5-trifluorophenyl)pyrrolidin-1-yl]pyrimidin-5-yl]oxyethyl]piperidin-1-yl]-1,2,4-oxadiazol-3-yl]cyclobutan-1-ol;hydrochloride |
| SMILES | C[C@H](Oc1cnc(N2C[C@H](c3cc(F)c(F)cc3F)[C@@H](N)C2)nc1)C1CCN(c2nc(C3(O)CCC3)no2)CC1.Cl |
| InChI | InChI=1S/C27H32F3N7O3.ClH/c1-15(16-3-7-36(8-4-16)26-34-24(35-40-26)27(38)5-2-6-27)39-17-11-32-25(33-12-17)37-13-19(23(31)14-37)18-9-21(29)22(30)10-20(18)28;/h9-12,15-16,19,23,38H,2-8,13-14,31H2,1H3;1H/t15-,19+,23-;/m0./s1 |
| InChIKey | VTKIBHVABABXBX-TXLBURBSSA-N |
| XLogP | 3.69 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.05 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|